(Z)-tetradec-9-enoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

myristoleic acid; (Z)-tetradec-9-enoic acid
CAS RN:[544-64-9]
Formula:C14H26O2; 226.36 g/mol
InChiKey:YWWVWXASSLXJHU-WAYWQWQTSA-N
SMILES:CCCCC=C/CCCCCCCC(O)=O
Molecular structure of (Z)-tetradec-9-enoic acid
Density:0.900 g/mL
Molar volume:251.5 mL/mol
Melting point:-5 °C

Isomers

citral diethyl acetal
Molecular structure of citral diethyl acetal
citronellyl butyrate
Molecular structure of citronellyl butyrate
citronellyl isobutyrate
Molecular structure of citronellyl isobutyrate
5-decyloxolan-2-one
Molecular structure of 5-decyloxolan-2-one
(1R,2R)-1,2-dicyclohexyl-1,2-ethanediol
Molecular structure of (1R,2R)-1,2-dicyclohexyl-1,2-ethanediol
(9Z)-9-dodecenyl acetate
Molecular structure of (9Z)-9-dodecenyl acetate
ethenyl dodecanoate
Molecular structure of ethenyl dodecanoate
λ-menthyl butanoate
Molecular structure of l-menthyl butanoate
menthyl butyrate
Molecular structure of menthyl butyrate
8-methylnonyl 2-methylprop-2-enoate
Molecular structure of 8-methylnonyl 2-methylprop-2-enoate
6-nonyloxan-2-one
Molecular structure of 6-nonyloxan-2-one
propyl 10-undecenoate
Molecular structure of propyl 10-undecenoate
(Z)-tetradec-9-enoic acid
Molecular structure of (Z)-tetradec-9-enoic acid
  ::